| Name |
Quinidine (+)-Quinidine |
| Formula |
C20H24N2O2 |
| Mw |
324.18377802 |
| CAS RN |
56-54-2 |
| C_ID |
C00031117
, 
|
| InChIKey |
LOUPRKONTZGTKE-YNHRJVTQNA-N |
| InChICode |
InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19+,20-/m0/s1 |
| SMILES |
C=C[C@H]1C[N@]2CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccc(OC)cc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Diaporthaceae | Diaporthe sp. CLF-J | Ref. |
| Plantae | Apocynaceae | Aspidosperma marcgravianum L. | Ref. |
| Plantae | Rubiaceae | Cinchona ledgariana | Ref. |
| Plantae | Rubiaceae | Cinchona ledgeriana | Ref. |
| Plantae | Rubiaceae | Cinchona officinalis  | Ref. |
| Plantae | Rubiaceae | Cinchona pubescens  | Ref. |
| Plantae | Rubiaceae | Cinchona robusta | Ref. |
| Plantae | Rubiaceae | Cinchona sp. | Ref. |
| Plantae | Rubiaceae | Cinchona spp. | Ref. |
| Plantae | Rubiaceae | Cinchona succirubra  | Ref. |
| Plantae | Rubiaceae | Remijia pedunculata | Ref. |
|
|
zoom in
| Organism | Cinchona succirubra | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|