| Name |
5-Caffeoylquinic acid Neochlorogenic acid 5-O-Caffeoylquinic acid Caffeoylquinic acid |
| Formula |
C16H18O9 |
| Mw |
354.09508217 |
| CAS RN |
906-33-2 |
| C_ID |
C00030807
, 
|
| InChIKey |
CWVRJTMFETXNAD-IJRKUMAHNA-N |
| InChICode |
InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14+,16-/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C[C@@](O)(C(=O)O)C[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Apiaceae | Ferula elaeochytris | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Aquifoliaceae | Ilex paraguariensis  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Aster salignus | Ref. |
| Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
| Plantae | Asteraceae | Centaurea pseudoscabiosa subsp.pseudoscabiosa Boiss.et aBuhse | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Solidago canadensis | Ref. |
| Plantae | Berberidaceae | Berberis microphylia | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Scabiosa comosa | Ref. |
| Plantae | Elaeagnaceae | Elaeagnus angustifolia  | Ref. |
| Plantae | Ericaceae | Rhododendron calophytum | Ref. |
| Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
| Plantae | Ericaceae | Rhododendron insigne | Ref. |
| Plantae | Ericaceae | Rhododendron kaempferi | Ref. |
| Plantae | Ericaceae | Rhododendron micranthum | Ref. |
| Plantae | Ericaceae | Rhododendron oreotrephes | Ref. |
| Plantae | Ericaceae | Rhododendron ponticum | Ref. |
| Plantae | Ericaceae | Rhododendron praevernum | Ref. |
| Plantae | Ericaceae | Rhododendron sp. | Ref. |
| Plantae | Ericaceae | Rhododendron ungernii | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea macrophylla cv.Hovaria  | Ref. |
| Plantae | Labiatae | Sideritis catillaris | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Veronica montana | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
| Plantae | Pteridaceae | Adiantum caudatum  | Ref. |
| Plantae | Ranunculaceae/Hydrastidaceae | Hydrastis canadensis  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Pyrus betulaefolia  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rubiaceae | Coffea canephora  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum acaule | Ref. |
| Plantae | Solanaceae | Solanum bulbocastanum | Ref. |
| Plantae | Solanaceae | Solanum canasense | Ref. |
| Plantae | Solanaceae | Solanum cardiophyllum | Ref. |
| Plantae | Solanaceae | Solanum chacoense | Ref. |
| Plantae | Solanaceae | Solanum commersonii  | Ref. |
| Plantae | Solanaceae | Solanum fendleri  | Ref. |
| Plantae | Solanaceae | Solanum habrochaites | Ref. |
| Plantae | Solanaceae | Solanum hougasii | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum multidissectum | Ref. |
| Plantae | Solanaceae | Solanum neorickii | Ref. |
| Plantae | Solanaceae | Solanum paniculatum | Ref. |
| Plantae | Solanaceae | Solanum parviflorum | Ref. |
| Plantae | Solanaceae | Solanum phureja | Ref. |
| Plantae | Solanaceae | Solanum pimpinellifollium | Ref. |
| Plantae | Solanaceae | Solanum pinnacritisectum | Ref. |
| Plantae | Solanaceae | Solanum stoloniferum | Ref. |
| Plantae | Solanaceae | Solanum tarijense | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Helianthus annuus | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|