| Name |
beta-Ionone (E)-beta-Ionone beta-lonone trans-beta-ionone |
| Formula |
C13H20O |
| Mw |
192.15141526 |
| CAS RN |
79-77-6 |
| C_ID |
C00029816
, 
|
| InChIKey |
PSQYTAPXSHCGMF-BQYQJAHWSA-N |
| InChICode |
InChI=1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8H,5-6,9H2,1-4H3/b8-7+ |
| SMILES |
CC(=O)/C=C/C1=C(C)CCCC1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Chromalveolata | Alariaceae | Undaria pinnatifida  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asteraceae | Centaurea sessilis | Ref. |
| Plantae | Asteraceae | Dittrichia graveolens  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Saussurea lappa  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Stellaria pallida | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Laminariaceae | Laminaria japonica  | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Oleaceae | Osmanthus fragrans  | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Rosaceae | Prunus armeniaca  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus salcina Lindl. (Blackamber,Friar) | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rubiaceae | Coffea canephora  | Ref. |
| Plantae | Rutaceae | Boronia megastigma | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Lycium chinense  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Valerianaceae | Nardostachys chinensis  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Microcystis aeruginosa | Ref. |
| - | - | Pandanous amryllifolius | Ref. |
|
|
zoom in
| Organism | Stellaria pallida | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|