| Name |
3beta-Hydroxystigmast-5-en-7-one 7-Oxo-beta-sitosterol Stigmast-5-en-3beta-ol-7-one |
| Formula |
C29H48O2 |
| Mw |
428.36543078 |
| CAS RN |
2034-74-4 |
| C_ID |
C00029593
, 
|
| InChIKey |
ICFXJOAKQGDRCT-QEFQULDFNA-N |
| InChICode |
InChI=1S/C29H48O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-27-25(13-15-29(23,24)6)28(5)14-12-22(30)16-21(28)17-26(27)31/h17-20,22-25,27,30H,7-16H2,1-6H3/t19-,20-,22+,23-,24+,25+,27+,28+,29-/m1/s1 |
| SMILES |
CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(=O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Inula cappa  | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Ebenaceae | Diospyros eriantha | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Labiatae | Salvia syriaca L. | Ref. |
| Plantae | Labiatae | Sideritis argosphacelus var. spicata | Ref. |
| Plantae | Labiatae | Sideritis discolor | Ref. |
| Plantae | Rutaceae | Zanthoxylum wutaiense | Ref. |
| Plantae | Salicaceae | Salix cheilophila | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
|
|
zoom in
| Organism | Salix cheilophila | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|