| Name |
2-Phenylethyl beta-D-glucopyranoside Phenethyl beta-D-glucopyranoside (-)-Phenethyl beta-D-glucopyranoside |
| Formula |
C14H20O6 |
| Mw |
284.12598837 |
| CAS RN |
18997-54-1 |
| C_ID |
C00029468
, 
|
| InChIKey |
MLRIJUWUQTVDQE-UWSPHAEVNA-N |
| InChICode |
InChI=1S/C14H20O6/c15-8-10-11(16)12(17)13(18)14(20-10)19-7-6-9-4-2-1-3-5-9/h1-5,10-18H,6-8H2/t10-,11-,12+,13-,14-/m1/s1 |
| SMILES |
OC[C@H]1O[C@@H](OCCc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Carum carvi L.  | Ref. |
| Plantae | Apiaceae | Cuminum cymimum L | Ref. |
| Plantae | Apiaceae | Glehnia littoralis  | Ref. |
| Plantae | Asteraceae | Baccharis indica | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata (HOOK.f.et Thoms.) H.OHBA | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum  | Ref. |
| Plantae | Rutaceae | Citrus unshiu  | Ref. |
| Plantae | Salicaceae | Salix acmophylla  | Ref. |
|
|
zoom in
| Organism | Salix acmophylla | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|