| Name |
Thalifoline |
| Formula |
C11H13NO3 |
| Mw |
207.08954329 |
| CAS RN |
21796-15-6 |
| C_ID |
C00026064
, 
|
| InChIKey |
WPKMGEQXTYQXGI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H13NO3/c1-12-4-3-7-5-10(15-2)9(13)6-8(7)11(12)14/h5-6,13H,3-4H2,1-2H3 |
| SMILES |
COc1cc2c(cc1O)C(=O)N(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona cherimola  | Ref. |
| Plantae | Annonaceae | Annona purpurea  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia elegans  | Ref. |
| Plantae | Berberidaceae | Berberis brandisiana | Ref. |
| Plantae | Berberidaceae | Berberis vulgaris  | Ref. |
| Plantae | Lauraceae | Cryptocarya longifolia | Ref. |
| Plantae | Menispermaceae | Abuta pahni (Martius) Krukoff & Barneby | Ref. |
| Plantae | Menispermaceae | Menispermum dauricum  | Ref. |
| Plantae | Papaveraceae | Argemone mexicana  | Ref. |
| Plantae | Ranunculaceae | Thalictrum minus var.adiantifolium | Ref. |
|
|
zoom in
| Organism | Menispermum dauricum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Zhang, et al., Phytochemistry, 65, (2004), 929 |
|---|
|