| Name |
(+)-Obamegine Obamegine Stepholine |
| Formula |
C36H38N2O6 |
| Mw |
594.27298696 |
| CAS RN |
479-37-8 |
| C_ID |
C00025981
, 
|
| InChIKey |
XGEAUXVPBXUBKN-YBFHJACQNA-N |
| InChICode |
InChI=1S/C36H38N2O6/c1-37-13-11-23-18-31(41-3)32-20-26(23)27(37)15-21-5-8-25(9-6-21)43-30-17-22(7-10-29(30)39)16-28-34-24(12-14-38(28)2)19-33(42-4)35(40)36(34)44-32/h5-10,17-20,27-28,39-40H,11-16H2,1-4H3/t27-,28+/m0/s1 |
| SMILES |
COc1cc2c3cc1Oc1c(O)c(OC)cc4c1[C@@H](Cc1ccc(O)c(c1)Oc1ccc(cc1)C[C@@H]3N(C)CC2)N(C)CC4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia columbiana | Ref. |
| Plantae | Berberidaceae | Berberis tschonoskiana | Ref. |
| Plantae | Berberidaceae | Berberis vulgaris  | Ref. |
| Plantae | Berberidaceae | Mahonia aquifolium | Ref. |
| Plantae | Berberidaceae | Mahonia repens  | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha Hayata  | Ref. |
| Plantae | Menispermaceae | Stephania japonica  | Ref. |
| Plantae | Menispermaceae | Triclisia gilletii (De Wild.) Staner  | Ref. |
| Plantae | Ranunculaceae | Thalictrum lucidum | Ref. |
| Plantae | Ranunculaceae | Thalictrum rugosum | Ref. |
| Plantae | Ranunculaceae | Xanthorhiza simplicissima | Ref. |
|
|
zoom in
| Organism | Thalictrum rugosum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Granell, et al., Planta Med, 70, (2004), 266 |
|---|
|