| Name |
Veprisine 7,8-Dimethoxy-N-methylflindersine NSC 363785 |
| Formula |
C17H19NO4 |
| Mw |
301.1314081 |
| CAS RN |
76525-26-3 |
| C_ID |
C00025446
, 
|
| InChIKey |
DWZSQRJGZJNUEK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H19NO4/c1-17(2)9-8-11-14(22-17)10-6-7-12(20-4)15(21-5)13(10)18(3)16(11)19/h6-9H,1-5H3 |
| SMILES |
COc1ccc2c3c(c(=O)n(C)c2c1OC)C=CC(C)(C)O3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Araliopsis soyauxii | Ref. |
| Plantae | Rutaceae | Araliopsis tabouensis | Ref. |
| Plantae | Rutaceae | Euxylophora paraensis | Ref. |
| Plantae | Rutaceae | Geijera balansae | Ref. |
| Plantae | Rutaceae | Glycosmis mauritiana | Ref. |
| Plantae | Rutaceae | Oricia renieri | Ref. |
| Plantae | Rutaceae | Stauranthus perforatus | Ref. |
| Plantae | Rutaceae | Vepris louisii | Ref. |
| Plantae | Rutaceae | Vepris stolzii | Ref. |
| Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
|
|
zoom in
| Organism | Zanthoxylum simulans | | Reference | Gray,Unpublished data,Chemistry and Chemical Taxonomy of the Rutales(1983),Academic Press,London,p 31. |
|---|
|