| Name |
Coelonin 2,7-Dihydroxy-4-methoxy-9,10-dihydrophenanthrene |
| Formula |
C15H14O3 |
| Mw |
242.09429431 |
| CAS RN |
82344-82-9 |
| C_ID |
C00015262
, 
|
| InChIKey |
OPPGAHUCKDKQJR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H14O3/c1-18-14-8-12(17)7-10-3-2-9-6-11(16)4-5-13(9)15(10)14/h4-8,16-17H,2-3H2,1H3 |
| SMILES |
COc1cc(O)cc2c1-c1ccc(O)cc1CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Orchidaceae | Bletilla striata  | Ref. |
| Plantae | Orchidaceae | Bulbophyllum reptans | Ref. |
| Plantae | Orchidaceae | Bulbophyllum vaginatum | Ref. |
| Plantae | Orchidaceae | Coelogyne elata | Ref. |
| Plantae | Orchidaceae | Coelogyne ochracea | Ref. |
| Plantae | Orchidaceae | Cymbidium aloifolium  | Ref. |
| Plantae | Orchidaceae | Eria flava | Ref. |
| Plantae | Orchidaceae | Eulophia nuda  | Ref. |
| Plantae | Orchidaceae | Eulophia petersii  | Ref. |
| Plantae | Orchidaceae | Gymnadenia albida | Ref. |
| Plantae | Orchidaceae | Pholidota chinensis Lindl.  | Ref. |
| Plantae | Orchidaceae | Pleione bulbocodioides | Ref. |
| Plantae | Orchidaceae | Scaphyglottis livida | Ref. |
|
|
zoom in
| Organism | Gymnadenia albida | | Reference | Braun,Orchinol, in Modern Methods of Plant Analysis, vol.6 (eds H.F.Linskens and M.V.Tracey),Springer Verlag, Berlin,(1963),130 |
|---|
|