| Name |
3-O-Galloylepicatechin-(4beta->8)-epigallocatechin-3-O-gallate |
| Formula |
C44H34O21 |
| Mw |
898.15925815 |
| CAS RN |
126715-90-0 |
| C_ID |
C00009219
, 
|
| InChIKey |
FUNWNVWJOMCWIL-DUDOAFAGNA-N |
| InChICode |
InChI=1S/C44H34O21/c45-18-10-23(49)33-31(11-18)62-40(14-1-2-20(46)22(48)3-14)42(65-44(61)17-8-29(55)38(59)30(56)9-17)35(33)34-24(50)13-21(47)19-12-32(63-43(60)16-6-27(53)37(58)28(54)7-16)39(64-41(19)34)15-4-25(51)36(57)26(52)5-15/h1-11,13,32,35,39-40,42,45-59H,12H2/t32-,35+,39+,40+,42+/m0/s1 |
| SMILES |
O=C(O[C@@H]1[C@@H](c2c(O)cc(O)c3c2O[C@H](c2cc(O)c(O)c(O)c2)[C@H](OC(=O)c2cc(O)c(O)c(O)c2)C3)c2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Rhododendron brachycarpum ssp.brachycarpum | Ref. |
| Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
| Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
| Plantae | Ericaceae | Rhododendron degronianum ssp. heptamerum var. hondoense | Ref. |
| Plantae | Ericaceae | Rhododendron dichroanthum ssp.scyphocalyx | Ref. |
| Plantae | Ericaceae | Rhododendron fortunei | Ref. |
| Plantae | Ericaceae | Rhododendron ponticum | Ref. |
| Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
| Plantae | Ericaceae | Rhododendron ungernii | Ref. |
| Plantae | Theaceae | Camellia sinensis var. viridis | Ref. |
|
|
zoom in
| Organism | Camellia sinensis var. viridis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Hashimoto,Chem.Pharm.Bull,37,(1989),3255 |
|---|
|