| Name |
Phloretin |
| Formula |
C15H14O5 |
| Mw |
274.08412356 |
| CAS RN |
60-82-2 |
| C_ID |
C00007936
, 
|
| InChIKey |
VGEREEWJJVICBM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H14O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-2,4-5,7-8,16-17,19-20H,3,6H2 |
| SMILES |
O=C(CCc1ccc(O)cc1)c1c(O)cc(O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum splendidum | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Ericaceae | Loiseleuria procumbens (L.) Desv. | Ref. |
| Plantae | Ericaceae | Pieris japonica | Ref. |
| Plantae | Fabaceae | Vicia faba | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
| Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
| Plantae | Rutaceae | Citrus limon | Ref. |
| Plantae | Salicaceae | Populus trichocarpa | Ref. |
| Plantae | Solanaceae | Capsicum annuum | Ref. |
|
|
zoom in
| Organism | Citrus limon |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Calixto, et al., Planta Med, 69, (2003), 973 |
|---|
|
