| Name |
Marein |
| Formula |
C21H22O11 |
| Mw |
450.11621155 |
| CAS RN |
535-96-6 |
| C_ID |
C00007893
, 
|
| InChIKey |
XGEYXJDOVMEJNG-YHXBCAFRNA-N |
| InChICode |
InChI=1S/C21H22O11/c22-8-15-18(28)19(29)20(30)21(32-15)31-14-6-3-10(16(26)17(14)27)11(23)4-1-9-2-5-12(24)13(25)7-9/h1-7,15,18-22,24-30H,8H2/b4-1+/t15-,18-,19+,20-,21-/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)c1ccc(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)c(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baeria chrysostoma | Ref. |
| Plantae | Asteraceae | Bidens pilosa  | Ref. |
| Plantae | Asteraceae | Coreopsis gigantea | Ref. |
| Plantae | Asteraceae | Coreopsis maritima | Ref. |
| Plantae | Asteraceae | Coreopsis martema | Ref. |
| Plantae | Asteraceae | Coreopsis neucensis | Ref. |
| Plantae | Asteraceae | Coreopsis tinctoria | Ref. |
| Plantae | Asteraceae | Simsia ghiesbreghtii | Ref. |
| Plantae | Asteraceae | Thelesperma megapotamicum  | Ref. |
| Plantae | Asteraceae | Viguiera dentata | Ref. |
| Plantae | Asteraceae | Zinnia linearis | Ref. |
| Plantae | Pinaceae | Abies pindrow  | Ref. |
|
|
zoom in
| Organism | Viguiera dentata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Hoffmann,Planta Med.,54,(1988),52
Hoffmann,Phytochem.,28,(1989),247 |
|---|
|