| Name |
Petunin Petunidin 3,5-di-O-beta-D-glucoside |
| Formula |
C28H33O17 |
| Mw |
641.17177463 |
| CAS RN |
25846-73-5 |
| C_ID |
C00006728
, 
|
| InChIKey |
KLRABYJGMPNMSA-LOHFLRHRNA-O |
| InChICode |
InChI=1S/C28H32O17/c1-40-15-3-9(2-12(32)19(15)33)26-16(43-28-25(39)23(37)21(35)18(8-30)45-28)6-11-13(41-26)4-10(31)5-14(11)42-27-24(38)22(36)20(34)17(7-29)44-27/h2-6,17-18,20-25,27-30,34-39H,7-8H2,1H3,(H2-,31,32,33)/p+1/t17-,18-,20-,21-,22+,23+,24-,25-,27-,28-/m1/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c3cc2O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)cc(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Elaeocarpaceae | Aristotelia chilensis  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia spp. | Ref. |
| Plantae | Geraniaceae | Pelargonium dolomiticum | Ref. |
| Plantae | Iridaceae | Crocus antalyensis | Ref. |
| Plantae | Iridaceae | Crocus sieberi | Ref. |
| Plantae | Iridaceae | Gladiolus spp. | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Myrsinaceae | Cyclamen persicum  | Ref. |
| Plantae | Myrtaceae | Metrosideros spp. | Ref. |
| Plantae | Onagraceae | Fuchsia spp. | Ref. |
| Plantae | Passifloraceae | Passiflora quadrangularis  | Ref. |
| Plantae | Rosaceae | Rosa spp. | Ref. |
| Plantae | Saxifragaceae | Saxifraga spp. | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
| Plantae | Vitaceae | Vitis rotundifolia  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| Plantae | Zingiberaceae | Renealmia regmelliana | Ref. |
|
|
zoom in
| Organism | Punica granatum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann.412,(1917),217 |
|---|
|