| Name |
Delphinidin 3-rhamnoside-5-glucoside |
| Formula |
C27H31O16 |
| Mw |
611.16120995 |
| CAS RN |
779266-92-1,53925-31-8 |
| C_ID |
C00006710
, 
|
| InChIKey |
IEMQNRLOUXMJQV-IAUWHCFENA-O |
| InChICode |
InChI=1S/C27H30O16/c1-8-18(32)21(35)23(37)26(39-8)42-16-6-11-14(40-25(16)9-2-12(30)19(33)13(31)3-9)4-10(29)5-15(11)41-27-24(38)22(36)20(34)17(7-28)43-27/h2-6,8,17-18,20-24,26-28,32,34-38H,7H2,1H3,(H3-,29,30,31,33)/p+1/t8-,17-,18+,20-,21+,22+,23+,24-,26+,27-/m1/s1 |
| SMILES |
CC1O[C@@H](Oc2cc3c(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)cc3[o+]c2-c2cc(O)c(O)c(O)c2)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cicer pinnatifidum | Ref. |
| Plantae | Fabaceae | Lathyrus japonicus | Ref. |
| Plantae | Fabaceae | Lathyrus latifolius | Ref. |
| Plantae | Fabaceae | Lathyrus odoratus  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia cracca  | Ref. |
| Plantae | Fabaceae | Vicia pseudo-orobus  | Ref. |
| Plantae | Fabaceae | Vicia unijuga  | Ref. |
| Plantae | Fabaceae | Vicia venosa | Ref. |
| Plantae | Ranunculaceae | Anemone hepatica  | Ref. |
| Plantae | Vitaceae | Ampelopsis brevipedunculata  | Ref. |
|
|
zoom in
| Organism | Anemone hepatica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,2,(1963),85 |
|---|
|