| Name |
Empetrin Delphinidin 3-O-beta-D-galactopyranoside |
| Formula |
C21H21O12 |
| Mw |
465.10330114 |
| CAS RN |
68852-84-6 |
| C_ID |
C00006697
, 
|
| InChIKey |
XENHPQQLDPAYIJ-XSYNRREMNA-O |
| InChICode |
InChI=1S/C21H20O12/c22-6-15-17(28)18(29)19(30)21(33-15)32-14-5-9-10(24)3-8(23)4-13(9)31-20(14)7-1-11(25)16(27)12(26)2-7/h1-5,15,17-19,21-22,28-30H,6H2,(H4-,23,24,25,26,27)/p+1/t15-,17-,18-,19+,21+/m0/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2cc(O)c(O)c(O)c2)C(O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus mas  | Ref. |
| Plantae | Ericaceae | Arbutus unedo  | Ref. |
| Plantae | Ericaceae | Cyathodes spp. | Ref. |
| Plantae | Ericaceae | Empetrum nigrum  | Ref. |
| Plantae | Ericaceae | Pentachondra spp. | Ref. |
| Plantae | Ericaceae | Trochocarpa spp. | Ref. |
| Plantae | Ericaceae | Vaccinium corymbosum  | Ref. |
| Plantae | Ericaceae | Vaccinium myrtillus L.  | Ref. |
| Plantae | Ericaceae | Vaccinium padifolium | Ref. |
| Plantae | Fabaceae | Anthyllis pyrenaica | Ref. |
| Plantae | Frankeniaceae | Frankenia grandiflora | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea candida  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea marliacea | Ref. |
| Plantae | Plumbaginaceae | Ceratostigma plumbaginoides | Ref. |
| Plantae | Sapindaceae | Blighia sieboldii | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
|
|
zoom in
| Organism | Anthyllis pyrenaica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Hayashi,Proc.Japan.Acad.,27,(1951),430
Tanchev,Phytochem.,8,(1969),2367 |
|---|
|