| Name |
Myricitrin Myricetin 3-O-alpha-L-rhamnopyranoside Myricetin 3-O-alpha-L-rhamnoside Myricetin 3-O-rhamnoside Myricetin 3-rhamnoside Myricetin-3-O-alpha-L-rhamnoside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
17912-87-7 |
| C_ID |
C00005730
, 
|
| InChIKey |
DCYOADKBABEMIQ-OWMUPTOHSA-N |
| InChICode |
InChI=1S/C21H20O12/c1-6-14(26)17(29)18(30)21(31-6)33-20-16(28)13-9(23)4-8(22)5-12(13)32-19(20)7-2-10(24)15(27)11(25)3-7/h2-6,14,17-18,21-27,29-30H,1H3/t6-,14-,17+,18+,21-/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2c(-c3cc(O)c(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Pistacia weinmannifolia J.Pisson ex.Franch  | Ref. |
| Plantae | Anacardiaceae | Rhus parviflora  | Ref. |
| Plantae | Asteraceae | Haplopappus bailahuen | Ref. |
| Plantae | Canellaceae | Warburgia stuhlmannii  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
| Plantae | Crassulaceae | Bryophyllum pinnatum  | Ref. |
| Plantae | Crassulaceae | Sedum kamtschaticum  | Ref. |
| Plantae | Cunoniaceae | Davidsonia pruriens  | Ref. |
| Plantae | Cupressaceae | Thuja orientalis  | Ref. |
| Plantae | Dilleniaceae | Doliocarpus spraguei  | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Fabaceae | Acacia aroma  | Ref. |
| Plantae | Fabaceae | Acacia saligna | Ref. |
| Plantae | Fabaceae | Caesalpinia pulcherrima  | Ref. |
| Plantae | Fabaceae | Caragana jubata | Ref. |
| Plantae | Fabaceae | Desmanthus illinoensis | Ref. |
| Plantae | Fabaceae | Flemingia congesta | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fagaceae | Quercus rubra  | Ref. |
| Plantae | Iridaceae | Patersonia spp. | Ref. |
| Plantae | Juglandaceae | Juglans mandshurica | Ref. |
| Plantae | Juglandaceae | Juglans nigra  | Ref. |
| Plantae | Leeaceae | Leea thorelii Gagnep | Ref. |
| Plantae | Myricaceae | Myrica rubra  | Ref. |
| Plantae | Myrsinaceae | Ardisia japonica  | Ref. |
| Plantae | Myrsinaceae | Lysimachia spp. | Ref. |
| Plantae | Myrtaceae | Eugenia edulis  | Ref. |
| Plantae | Myrtaceae | Luma chequen  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Myrtaceae | Plinia pinnata | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Nymphaeaceae | Nymphaea lotus  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea odorata  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus acidus  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Plumbaginaceae | Armeria sp. | Ref. |
| Plantae | Plumbaginaceae | Ceratostigma willmottianum | Ref. |
| Plantae | Plumbaginaceae | Limonium spp. | Ref. |
| Plantae | Polygalaceae | Polygala chinensis  | Ref. |
| Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
| Plantae | Restionaceae | Chondropetalum spp. | Ref. |
| Plantae | Restionaceae | Elegia capensis | Ref. |
| Plantae | Sapotaceae | Diploknema butyracea | Ref. |
| Plantae | Sapotaceae | Manilkara zapota cv.Tikal  | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
| Plantae | Saxifragaceae | Heuchera spp. | Ref. |
| Plantae | Saxifragaceae | Lithophragma spp. | Ref. |
| Plantae | Saxifragaceae | Rodgersia podophylla  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Taxodiaceae | Metasequoia glyptostroboides | Ref. |
| Plantae | Vitaceae | Ampelopsis grossedentata | Ref. |
| Plantae | Zingiberaceae | Hedychium spp. | Ref. |
| - | - | Peltiphyllum peltatum | Ref. |
| - | - | Sarcolaeana multiflora | Ref. |
|
|
zoom in
| Organism | Davidsonia pruriens | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Shibata,J.Am.Chem.Soc.,41,(1919),208
Zapesochnaya,Khim.Prir.Soedin.,(1982),695 |
|---|
|