| Name |
Isorhamnetin 3-O-neohesperidoside Isorhamnetin 3-neohesperidoside Isorhamnetin-3-O-neohesperidoside |
| Formula |
C28H32O16 |
| Mw |
624.16903498 |
| CAS RN |
55033-90-4 |
| C_ID |
C00005547
, 
|
| InChIKey |
QHLKSZBFIJJREC-GHLOOZCJNA-N |
| InChICode |
InChI=1S/C28H32O16/c1-9-18(33)21(36)23(38)27(40-9)44-26-22(37)19(34)16(8-29)42-28(26)43-25-20(35)17-13(32)6-11(30)7-15(17)41-24(25)10-3-4-12(31)14(5-10)39-2/h3-7,9,16,18-19,21-23,26-34,36-38H,8H2,1-2H3/t9-,16-,18-,19-,21+,22-,23-,26+,27-,28-/m0/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2OC(CO)[C@@H](O)C(O)C2O[C@@H]2OC(C)[C@H](O)C(O)[C@@H]2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Calendula officinalis  | Ref. |
| Plantae | Cactaceae | Opuntia ficus-indica var.saboten  | Ref. |
| Plantae | Cruciferae | Nerisyrenia gracilis | Ref. |
| Plantae | Cruciferae | Nerisyrenia linearifolia | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Typhaceae | Typha angustata  | Ref. |
| Plantae | Typhaceae | Typha latifolia  | Ref. |
| Plantae | Urticaceae | Parietaria officinalis  | Ref. |
|
|
zoom in
| Organism | Parietaria officinalis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Ceska,Phytochem.,23,(1984),1822
Budzianowski,J.Nat.Prod.,48,(1985),336 |
|---|
|