| Name |
Kaempferol 3,4'-di-O-beta-D-glucopyranoside Kaempferol 3,4'-diglucoside 3-(beta-D-Glucopyranosyloxy)-2-[4-(beta-D-glucopyranosyloxy)phenyl]-5,7-dihydroxy-4H-1-benzopyran-4-one |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
71939-16-7 |
| C_ID |
C00005194
, 
|
| InChIKey |
CRHCCDOCWGWLSH-MAUJFVQSNA-N |
| InChICode |
InChI=1S/C27H30O16/c28-7-14-17(32)20(35)22(37)26(41-14)39-11-3-1-9(2-4-11)24-25(19(34)16-12(31)5-10(30)6-13(16)40-24)43-27-23(38)21(36)18(33)15(8-29)42-27/h1-6,14-15,17-18,20-23,26-33,35-38H,7-8H2/t14-,15+,17-,18-,20+,21+,22-,23+,26-,27+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)c(-c2ccc(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium tuberosum  | Ref. |
| Plantae | Alliaceae | Allium victorialis  | Ref. |
| Plantae | Apiaceae | Smyrnium perfoliatum | Ref. |
| Plantae | Convallariaceae | Ophiopogon jaburan | Ref. |
| Plantae | Cruciferae | Crambe tataria | Ref. |
| Plantae | Cruciferae | Sisymbrium gilliesii | Ref. |
| Plantae | Fabaceae | Astragalus complanatus  | Ref. |
| Plantae | Iridaceae | Crocus antalyensis | Ref. |
| Plantae | Iridaceae | Crocus speciosus | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
|
|
zoom in
| Organism | Picea abies | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Ishikura,Agric.Biol.Chem.,43,(1979),1923
Strack,Phytochem.,28,(1989),2071 |
|---|
|