| Name |
Kaempferol 7-alpha-L-arabinoside |
| Formula |
C20H18O10 |
| Mw |
418.0899968 |
| CAS RN |
70427-13-3 |
| C_ID |
C00005145
, 
|
| InChIKey |
CCBSGQDAQUZKPI-VMCBFRKUNA-N |
| InChICode |
InChI=1S/C20H18O10/c21-9-3-1-8(2-4-9)19-17(26)16(25)14-11(22)5-10(6-13(14)30-19)29-20-18(27)15(24)12(23)7-28-20/h1-6,12,15,18,20-24,26-27H,7H2/t12-,15-,18+,20-/m1/s1 |
| SMILES |
O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O[C@@H]3OC[C@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Sedum populifolium | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cyatheaceae | Cyathea haucockii | Ref. |
| Plantae | Cyatheaceae | Cyathea podophylla | Ref. |
| Plantae | Dryopteridaceae | Cyrtomium falcatum | Ref. |
| Plantae | Dryopteridaceae | Cyrtomium fortunei  | Ref. |
| Plantae | Dryopteridaceae | Polystichum lepidocaulon | Ref. |
| Plantae | Onocleaceae/Dryopteridaceae | Matteuccia orientalis  | Ref. |
| Plantae | Onocleaceae/Dryopteridaceae | Matteuccia struthiopteris  | Ref. |
| - | - | Drypteris spp. | Ref. |
|
|
zoom in
| Organism | Drypteris spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Hiraoka, Bot.Mag.Tokyo,88,(1975),127
Hiraoka,Biochem.Syst.Ecol.,6,(1978),171 |
|---|
|