| Name |
Syringetin |
| Formula |
C17H14O8 |
| Mw |
346.06886743 |
| CAS RN |
4423-37-4 |
| C_ID |
C00004767
, 
|
| InChIKey |
UZMAPBJVXOGOFT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O8/c1-23-11-3-7(4-12(24-2)14(11)20)17-16(22)15(21)13-9(19)5-8(18)6-10(13)25-17/h3-6,18-20,22H,1-2H3 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus salicifolia | Ref. |
| Plantae | Cistaceae | Cistus symphytifolius | Ref. |
| Plantae | Fabaceae | Lathyrus pratensis | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Meliaceae | Soymida febrifuga  | Ref. |
| Plantae | Pinaceae | Cedrus atlantica | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Turneraceae | Turnera subulata | Ref. |
|
|
zoom in
| Organism | Turnera subulata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|