| Name |
5-Hydroxyauranetin 5-Hydroxy-3,6,7,8,4'-pentamethoxyflavone 5-Hydroxy-3,6,7,8-tetramethoxy-2-(4-methoxyphenyl)-4H-1-Benzopyran-4-one |
| Formula |
C20H20O8 |
| Mw |
388.11581762 |
| CAS RN |
50439-46-8 |
| C_ID |
C00004673
, 
|
| InChIKey |
KBYYZSYVUWCARH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O8/c1-23-11-8-6-10(7-9-11)15-17(24-2)13(21)12-14(22)18(25-3)20(27-5)19(26-4)16(12)28-15/h6-9,22H,1-5H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(OC)c(OC)c(O)c3c(=O)c2OC)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gnaphalium affine  | Ref. |
| Plantae | Capparaceae | Cleome spinosa  | Ref. |
| Plantae | Cleomaceae | Polanisia trachysperma | Ref. |
| Plantae | Combretaceae | Calycopteris floribunda  | Ref. |
| Plantae | Labiatae | Stachys aegyptiaca | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus menziesii | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus nervosa | Ref. |
| Plantae | Plantaginaceae | Antirrhinum hispanicum | Ref. |
| Plantae | Plantaginaceae | Digitalis viridiflora | Ref. |
| Plantae | Rosaceae | Rosa centifolia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Drummondita calida | Ref. |
|
|
zoom in
| Organism | Rosa centifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Sarin,Tetrahedron,8,(1960),64 |
|---|
|