| Name |
3,5,7-Trihydroxy-6,4'-dimethoxyflavone 6,4'-Dimethoxy-3,5,7-trihydroxyflavone |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
35214-88-1 |
| C_ID |
C00004600
, 
|
| InChIKey |
MSLBFGWANLXSOK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-9-5-3-8(4-6-9)16-15(21)13(19)12-11(24-16)7-10(18)17(23-2)14(12)20/h3-7,18,20-21H,1-2H3 |
| SMILES |
COc1ccc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Arnica spp. | Ref. |
| Plantae | Asteraceae | Balsamorhiza spp. | Ref. |
| Plantae | Asteraceae | Centaurea alexandrina | Ref. |
| Plantae | Asteraceae | Eupatorium glandulosum | Ref. |
| Plantae | Asteraceae | Gnaphalium microcephalum | Ref. |
| Plantae | Betulaceae | Betula ermanii | Ref. |
| Plantae | Boraginaceae | Onosma hispida  | Ref. |
| Plantae | Didiereaceae | Alluaudia spp. | Ref. |
| Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
| Plantae | Rosaceae | Rosa centifolia  | Ref. |
|
|
zoom in
| Organism | Rosa centifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wollenweber,Z.Naturforsch.B.,26,(1971),1188 |
|---|
|