| Name |
Eupafolin 6-Methoxyluteolin Nepetin |
| Formula |
C16H12O7 |
| Mw |
316.05830274 |
| CAS RN |
520-11-6 |
| C_ID |
C00003885
, 
|
| InChIKey |
FHHSEFRSDKWJKJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O7/c1-22-16-11(20)6-13-14(15(16)21)10(19)5-12(23-13)7-2-3-8(17)9(18)4-7/h2-6,17-18,20-21H,1H3 |
| SMILES |
COc1c(O)cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baccharis gaudichaudiana DC | Ref. |
| Plantae | Asteraceae | Brickellia dentata | Ref. |
| Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
| Plantae | Asteraceae | Cirsium oligophyllum | Ref. |
| Plantae | Asteraceae | Haplopappus scrobiculatus | Ref. |
| Plantae | Asteraceae | Inula viscosa  | Ref. |
| Plantae | Asteraceae | Staehelina dubia | Ref. |
| Plantae | Asteraceae | Tithonia diversifolia  | Ref. |
| Plantae | Asteraceae | Viguiera gardneri | Ref. |
| Plantae | Asteraceae | Wyethia helenioides | Ref. |
| Plantae | Labiatae | Nepeta hindostana  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Plantaginaceae | Digitalis schischkinii | Ref. |
| Plantae | Verbenaceae | Lantana fucata  | Ref. |
| Plantae | Verbenaceae | Lippia nodiflora  | Ref. |
|
|
zoom in
| Organism | Wyethia helenioides | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Brieskorn,Tetrahedron Lett.,(1968),3447
Ates,J.Nat.Prod.,45,(1982),189 |
|---|
|