| Name |
Isoscutellarein 8-Hydroxyapigenin 4',5,7,8-Tetrahydroxyflavone 5,7,8-Trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C15H10O6 |
| Mw |
286.04773805 |
| CAS RN |
41440-05-5 |
| C_ID |
C00003848
, 
|
| InChIKey |
NXHQVROAKYDSNW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)12-6-10(18)13-9(17)5-11(19)14(20)15(13)21-12/h1-6,16-17,19-20H |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2c(O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baccharis pilularis | Ref. |
| Plantae | Asteraceae | Odixia achlaena | Ref. |
| Plantae | Asteraceae | Odixia angusta | Ref. |
| Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria indica | Ref. |
| Plantae | Lentibulariaceae | Pinguicula vulgaris  | Ref. |
|
|
zoom in
| Organism | Scutellaria indica | | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001) |
|---|
|