| Name |
Fucosterol
(24R)24-Ethylcholesta-5,24(28)-dien-3beta-ol |
| Formula |
C29H48O |
| Mw |
412.37051615 |
| CAS RN |
17605-67-3 |
| C_ID |
C00003653
, 
|
| InChIKey |
OSELKOCHBMDKEJ-GNSKQFMSNA-N |
| InChICode |
InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h7,10,19-20,23-27,30H,8-9,11-18H2,1-6H3/b21-7+/t20-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| SMILES |
C/C=C(CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Dendrophylliidae | Turbinaria conoides | Ref. |
| Chromalveolata | Dictyotaceae | Dictyopteris divaricata | Ref. |
| Chromalveolata | Dictyotaceae | Spatoglossum variabile | Ref. |
| Chromalveolata | Leptomitaceae | Apodachlya brachynema | Ref. |
| Chromalveolata | Leptomitaceae | Apodachlya minima | Ref. |
| Chromalveolata | Saprolegniaceae | Aplanopsis terrestris | Ref. |
| Chromalveolata | Saprolegniaceae | Saprolegnia ferax | Ref. |
| Chromalveolata | Saprolegniaceae | Saprolegnia megasperma | Ref. |
| Fungi | Apodachlyellaceae | Apodachlyella completa | Ref. |
| Fungi | Saprolegniaceae | Achyla bisexualis | Ref. |
| Plantae | Asphodelaceae | Asphodelus albus  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fucaceae | Fucus vesiculosus | Ref. |
| Plantae | Laminariaceae | Laminaria japonica | Ref. |
| Plantae | Orchidaceae | Sarcophyton crassocaule | Ref. |
| Plantae | Palmae | Cocos nucifera | Ref. |
| Plantae | Santalaceae | Santalum album | Ref. |
| Plantae | Solanaceae | Solanum tuberosum | Ref. |
| - | - | Dictyota dichotoma (Huds.) | Ref. |
| - | - | Furcellaria fastigiata | Ref. |
| - | - | Leptolegnia caudata | Ref. |
| - | - | Patinopecten yessoensis | Ref. |
| - | - | Pythiopsis cymosa | Ref. |
|
|
zoom in
| Organism | Achyla bisexualis |
|---|
| Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Seitz,J.Agric.Food Chem.,25,(1977),838-841
Turner,Fungal Metabolites II,Academic Press,New York,NY,631 pp.(1983)
Weete,Structure and Function |
|---|
|
