| Name |
Cornin Verbenalin |
| Formula |
C17H24O10 |
| Mw |
388.13694699 |
| CAS RN |
548-37-8 |
| C_ID |
C00003102
, 
|
| InChIKey |
HLXRWTJXGMHOFN-FGBKZHRTNA-N |
| InChICode |
InChI=1S/C17H24O10/c1-6-3-8(19)11-7(15(23)24-2)5-25-16(10(6)11)27-17-14(22)13(21)12(20)9(4-18)26-17/h5-6,9-14,16-18,20-22H,3-4H2,1-2H3/t6-,9+,10+,11-,12+,13-,14+,16-,17-/m0/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)[C@H]2[C@@H]1C(=O)C[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus florida | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus spp. | Ref. |
| Plantae | Plantaginaceae | Penstemon grandiflorus | Ref. |
| Plantae | Plantaginaceae | Penstemon mucronatus | Ref. |
| Plantae | Plantaginaceae | Penstemon secundiflorus | Ref. |
| Plantae | Symplocaceae | Symplocos glauca | Ref. |
| Plantae | Verbenaceae | Verbena brasiliensis | Ref. |
| Plantae | Verbenaceae | Verbena hastata | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| Plantae | Verbenaceae | Verbena spp. | Ref. |
| Plantae | Verbenaceae | Verbena stricta | Ref. |
|
|
zoom in
| Organism | Verbena hastata | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|