| Name |
E-Pterostilbene Pterostilbene 3,5-Dimethoxy-4'-hydroxystilbene |
| Formula |
C16H16O3 |
| Mw |
256.10994438 |
| CAS RN |
537-42-8 |
| C_ID |
C00002902
, 
|
| InChIKey |
VLEUZFDZJKSGMX-ONEGZZNKSA-N |
| InChICode |
InChI=1S/C16H16O3/c1-18-15-9-13(10-16(11-15)19-2)4-3-12-5-7-14(17)8-6-12/h3-11,17H,1-2H3/b4-3+ |
| SMILES |
COc1cc(/C=C/c2ccc(O)cc2)cc(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Fabaceae | Dalea versicolor | Ref. |
| Plantae | Fabaceae | Pterocarpus dalbergioides  | Ref. |
| Plantae | Fabaceae | Pterocarpus macrocarpus | Ref. |
| Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
| Plantae | Fabaceae | Pterocarpus soyauxii  | Ref. |
| Plantae | Fabaceae | Pterocarpus tinctorius | Ref. |
| Plantae | Fabaceae | Pterolobium hexapetallum | Ref. |
| Plantae | Vitaceae | Vitis coignetiae  | Ref. |
| Plantae | Vitaceae | Vitis riparia  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis coignetiae | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|