| Name |
Lucidin |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
478-08-0 |
| C_ID |
C00002838
, 
|
| InChIKey |
AMIDUPFSOUCLQB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-6-10-11(17)5-9-12(15(10)20)14(19)8-4-2-1-3-7(8)13(9)18/h1-5,16-17,20H,6H2 |
| SMILES |
O=C1c2ccccc2C(=O)c2c1cc(O)c(CO)c2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lauraceae | Lindera lucida | Ref. |
| Plantae | Rubiaceae | Asperula odorata  | Ref. |
| Plantae | Rubiaceae | Coelospermum reticulatum | Ref. |
| Plantae | Rubiaceae | Coprosma rotundifolia | Ref. |
| Plantae | Rubiaceae | Galium spp. | Ref. |
| Plantae | Rubiaceae | Hymenodictyon excelsum | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia | Ref. |
| Plantae | Rubiaceae | Morinda officinalis | Ref. |
| Plantae | Rubiaceae | Morinda umbellata | Ref. |
| Plantae | Rubiaceae | Rubia tinctorum | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana DECNE | Ref. |
| - | - | Commitheca liebrechtsiana | Ref. |
|
|
zoom in
| Organism | Rubia tinctorum |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
WU, et al., Chem Pharm Bull, 51, (2003), 948
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter43 |
|---|
|
