| Name |
Apoatropine Apohyoscyamine |
| Formula |
C17H21NO2 |
| Mw |
271.15722892 |
| CAS RN |
500-55-0 |
| C_ID |
C00002275
, 
|
| InChIKey |
WPUIZWXOSDVQJU-QPTIHUKZNA-N |
| InChICode |
InChI=1S/C17H21NO2/c1-12(13-6-4-3-5-7-13)17(19)20-16-10-14-8-9-15(11-16)18(14)2/h3-7,14-16H,1,8-11H2,2H3/t14-,15+,16- |
| SMILES |
C=C(C(=O)O[C@H]1CC2CC[C@H](C1)N2C)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Anthotroche myoporoides | Ref. |
| Plantae | Solanaceae | Anthotroche pannosa | Ref. |
| Plantae | Solanaceae | Atropa baetica | Ref. |
| Plantae | Solanaceae | Atropa bella-donna | Ref. |
| Plantae | Solanaceae | Atropa belladonna  | Ref. |
| Plantae | Solanaceae | Datura ceratocaula  | Ref. |
| Plantae | Solanaceae | Datura stramonium x D.discolor  | Ref. |
| Plantae | Solanaceae | Hyoscyamus albus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Mandragora turcomanica Mizger | Ref. |
| Plantae | Solanaceae | Mandragora vernalis | Ref. |
| Plantae | Solanaceae | Physochlaina alaica | Ref. |
| Plantae | Solanaceae | Physochlaina orientalis | Ref. |
|
|
zoom in
| Organism | Hyoscyamus desertorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|