| Name |
Retronecine |
| Formula |
C8H13NO2 |
| Mw |
155.09462867 |
| CAS RN |
480-85-3 |
| C_ID |
C00002108
, 
|
| InChIKey |
HJSJELVDQOXCHO-YZYOREDDNA-N |
| InChICode |
InChI=1S/C8H13NO2/c10-5-6-1-3-9-4-2-7(11)8(6)9/h1,7-8,10-11H,2-5H2/t7-,8-/m1/s1 |
| SMILES |
OCC1=CCN2CC[C@@H](O)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Senecio inaequidens | Ref. |
| Plantae | Asteraceae | Senecio pseudo-orientalis | Ref. |
| Plantae | Asteraceae | Senecio vernalis | Ref. |
| Plantae | Asteraceae | Senecio vulgaris  | Ref. |
| Plantae | Boraginaceae | Heliotropium angiospermum  | Ref. |
| Plantae | Boraginaceae | Heliotropium bracteatum | Ref. |
| Plantae | Boraginaceae | Heliotropium curassavicum | Ref. |
| Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
| Plantae | Boraginaceae | Heliotropium ovalifolium | Ref. |
| Plantae | Boraginaceae | Heliotropium spathulatum | Ref. |
| Plantae | Fabaceae | Crotalaria spp. | Ref. |
|
|
zoom in
| Organism | Heliotropium spathulatum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|