| Name |
Pretazettine |
| Formula |
C18H21NO5 |
| Mw |
331.14197279 |
| CAS RN |
17322-84-8 |
| C_ID |
C00001580
, 
|
| InChIKey |
KLJOYDMUWKSYBP-MCWXQHLKNA-N |
| InChICode |
InChI=1S/C18H21NO5/c1-19-8-16-18(4-3-10(21-2)5-15(18)19)12-7-14-13(22-9-23-14)6-11(12)17(20)24-16/h3-4,6-7,10,15-17,20H,5,8-9H2,1-2H3/t10-,15+,16+,17-,18+/m1/s1 |
| SMILES |
CO[C@@H]1C=CC23c4cc5c(cc4[C@H](O)O[C@H]2CN(C)[C@H]3C1)OCO5 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Hippeastrum equestre | Ref. |
| Plantae | Amaryllidaceae | Hymenocallis cayamansis | Ref. |
| Plantae | Amaryllidaceae | Hymenocallis tubiflora  | Ref. |
| Plantae | Amaryllidaceae | Ismene calithina | Ref. |
| Plantae | Amaryllidaceae | Leucojum aestivum  | Ref. |
| Plantae | Amaryllidaceae | Lycoris radiata  | Ref. |
| Plantae | Amaryllidaceae | Narcissus tazetta  | Ref. |
| Plantae | Amaryllidaceae | Pancratium biflorum | Ref. |
| Plantae | Amaryllidaceae | Sprekelia formosissima | Ref. |
| Plantae | Amaryllidaceae | Zephyranthes candida | Ref. |
| Plantae | Amaryllidaceae | Zephyranthes carinata  | Ref. |
|
|
zoom in
| Organism | Zephyranthes candida | | Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|