| Name |
Kaempferide |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
491-54-3 |
| C_ID |
C00001060
, 
|
| InChIKey |
SQFSKOYWJBQGKQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
| SMILES |
COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Semecarpus vitiensis | Ref. |
| Plantae | Asteraceae | Baccharis pilularis | Ref. |
| Plantae | Asteraceae | Baccharis viminea | Ref. |
| Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
| Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
| Plantae | Calceolariaceae | Calceolaria irazeunsis | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Costaceae | Costus spicatus  | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cunoniaceae | Eucryphia jinksii | Ref. |
| Plantae | Fabaceae | Astragalus complanatus  | Ref. |
| Plantae | Fabaceae | Genista aetnensis | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon sessilifolium | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus menziesii | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus nervosa | Ref. |
| Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
| Plantae | Plantaginaceae | Linaria dalmatica | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Tamaricaceae | Tamarix chinensis | Ref. |
| Plantae | Zingiberaceae | Alpinia officinarum  | Ref. |
| Plantae | Zingiberaceae | Kaempferia galanga  | Ref. |
| - | - | Currania robertiana | Ref. |
|
|
zoom in
| Organism | Capsella bursa-pastoris | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
LI, et al., Chem Pharm Bull, 50, (2002), 1305.
Shin, et al., Journal of Natural Products, 65, (2002), 1315.
Hu, et al., Chinese J of Pharm Analysis, 30, (2010), 504 |
|---|
|