| Name |
Baicalein
Noroxylin
5,6,7-Trihydroxyflavone |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
491-67-8 |
| C_ID |
C00001022
, 
|
| InChIKey |
FXNFHKRTJBSTCS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-9-6-11(8-4-2-1-3-5-8)20-12-7-10(17)14(18)15(19)13(9)12/h1-7,17-19H |
| SMILES |
O=c1cc(-c2ccccc2)oc2cc(O)c(O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Oroxylum indicum  | Ref. |
| Plantae | Cactaceae | Austrocylindropuntia subulata | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Trifolium pratense | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis | Ref. |
| Plantae | Labiatae | Scutellaria lateriflora | Ref. |
| Plantae | Labiatae | Scutellaria oreophila | Ref. |
| Plantae | Labiatae | Scutellaria spp. | Ref. |
| Plantae | Plantaginaceae | Plantago major | Ref. |
|
|
zoom in
| Organism | Plantago major |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harborne,Comparative Biochemistry of the Flavonoids, (1967) Academic Press
Burret,J.Nat.Prod.,82,(1982),667 |
|---|
|
