| Name |
Lirioresinol B
(-)-Lirioresinol B
(-)-Syringaresinol |
| Formula |
C22H26O8 |
| Mw |
418.16276781 |
| CAS RN |
6216-81-5 |
| C_ID |
C00000627
, 
|
| InChIKey |
KOWMJRJXZMEZLD-RONXCAPDNA-N |
| InChICode |
InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3/t13-,14-,21+,22+/m1/s1 |
| SMILES |
COc1cc([C@@H]2OC[C@@H]3[C@H]2CO[C@H]3c2cc(OC)c(O)c(OC)c2)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araceae | Rhaphidophora decursiva  | Ref. |
| Plantae | Asteraceae | Artemisia minor | Ref. |
| Plantae | Celastraceae | Gymnosporia trigyna | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii Hook F.(TwHF) | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Magnoliaceae | Magnolia fargesii | Ref. |
| Plantae | Malvaceae | Helicteres angustifolia | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Piperaceae | Peperomia duclouxii C. DC. | Ref. |
| Plantae | Putranjivaceae | Drypetes molunduana Pax and Hoffm | Ref. |
| Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
| Plantae | Simaroubaceae | Leitneria floridana | Ref. |
| - | - | Selaginella doederleinii | Ref. |
|
|
zoom in
| Organism | Drypetes molunduana Pax and Hoffm |
|---|
| Reference | Wandji,Phytochem.,54,(2000),811 |
|---|
|
