| Name |
(+)-Dihydrokaempferol dihydrokaempferol Dihydrokaempferol (+)-Aromadendrin Katuranin (2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one (2R,3R)-Aromadendrin (+)-(2R,3R)-Dihydrokaempferol Aromadendrin |
| Formula |
C15H12O6 |
| Mw |
288.06338812 |
| CAS RN |
480-20-6 |
| C_ID |
C00007234
, 
|
| InChIKey |
PADQINQHPQKXNL-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C15H12O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,14-18,20H/t14-,15-/m0/s1 |
| SMILES |
O=C1c2c(O)cc(O)cc2O[C@H](c2ccc(O)cc2)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Artemisia vestita  | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia schomburgkiana | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica carinata Y line  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis pisifera | Ref. |
| Plantae | Cupressaceae | Juniperus lucayana | Ref. |
| Plantae | Cupressaceae | Thuja orientalis  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Fabaceae | Acacia catechu  | Ref. |
| Plantae | Fabaceae | Afzelia bella | Ref. |
| Plantae | Fabaceae | Cassia fistula  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Spatholobus suberectus Dunn  | Ref. |
| Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum compactum  | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Lamiaceae | Coleus blumei  | Ref. |
| Plantae | Lythraceae | Punica granatum L.  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Malvaceae | Tilia platyphyllos  | Ref. |
| Plantae | Meliaceae | Xylocarpus granatum  | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea  | Ref. |
| Plantae | Moraceae | Maclura tinctoria  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
| Plantae | Myrtaceae | Eucalyptus macathurii | Ref. |
| Plantae | Myrtaceae | Eucalyptus mackliana | Ref. |
| Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus dombeyi  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Pinaceae | Abies lasiocarpa | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Plantaginaceae | Antirrhinum majus  | Ref. |
| Plantae | Platanaceae | Platanus vulgaris | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Podocarpaceae | Podocarpus spp. | Ref. |
| Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
| Plantae | Rhamnaceae | Hovenia dulcis  | Ref. |
| Plantae | Rhamnaceae | Phyllogeiton zeyheri Sond. | Ref. |
| Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
| Plantae | Rhamnaceae | Rhamnus pallasii | Ref. |
| Plantae | Rhamnaceae | Ventilago leiocarpa | Ref. |
| Plantae | Rosaceae | Prunus amygdalus  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus davidiana  | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Flindersia australis | Ref. |
| Plantae | Rutaceae | Phellodendron amurense var.wilsonii  | Ref. |
| Plantae | Salicaceae | Salix caprea  | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Petunia hybrida | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Vitaceae | Ampelopsis brevipedunculata  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Equsetum arvense | Ref. |
| - | - | Nympaea spp. | Ref. |
|
|
zoom in
| Organism | Ampelopsis brevipedunculata | | Reference | Zhang, et al., Phytochemistry, 66, (2005), 2759.
Fukai, et al., Journal of Natural Products, 66, (2003), 1118.
Wu, et al., Journal of Natural Products, 66, (2003), 1207.
ZHANG, et al., Chem Pharm Bull, 50, (2002), 841.
XIAO, et al., Chem Pharm Bull, 49, (2001), 1479.
Lee, et al., Journal of Natural Products, 64, (2001), 1286.
Lin, et al., Journal of Natural Products, 64, (2001), 674.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Ding, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 32, (1997), 600.
Xu, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 20, (1995), 484. |
|---|
|