| Name |
Cinnamic acid (E)-Cinnamic acid .beta-Phenylacrylic acid |
| Formula |
C9H8O2 |
| Mw |
148.0524295 |
| CAS RN |
621-82-9 |
| C_ID |
C00029961
, 
|
| InChIKey |
WBYWAXJHAXSJNI-VOTSOKGWSA-N |
| InChICode |
InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
| SMILES |
O=C(O)/C=C/c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Acanthaceae | Andrographis paniculata  | Ref. |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Annonaceae | Goniothalamus amuyon | Ref. |
| Plantae | Annonaceae | Polyalthia crassa | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Araliaceae | Panax notoginseng  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Achillea alexandri-regis Bornm.& Rudski | Ref. |
| Plantae | Balanophoraceae | Balanophora abbreviata B1 | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cymodoceaceae | Syringodium filiforme | Ref. |
| Plantae | Ephedraceae | Ephedra equisetina  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Myroxylon pereirae  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca  | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus bracteatus  | Ref. |
| Plantae | Haemodoraceae | Anigozanthos preissii | Ref. |
| Plantae | Illiciaceae | Illicium fargesii | Ref. |
| Plantae | Juglandaceae | Engelhardia roxburghiana | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Lauraceae | Cinnamomum burmannii Nees ex BI  | Ref. |
| Plantae | Lauraceae | Cinnamomum cassia  | Ref. |
| Plantae | Lauraceae | Cinnamomum japonicum | Ref. |
| Plantae | Liliaceae | Lilium candidum  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Lythraceae | Punica granatum L.  | Ref. |
| Plantae | Oleaceae | Syringa afghanica | Ref. |
| Plantae | Pedaliaceae | Harpagophytum procumbens  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Plantaginaceae | Picrorhiza kurooa  | Ref. |
| Plantae | Plantaginaceae | Picrorhiza scrophulariiflora  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Tarenna attenuata | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Salicaceae | Populus trichocarpa | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Scrophulariaceae | Scrophularia huergeriana | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia nodosa  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Lycium chinense  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Solanum acaule | Ref. |
| Plantae | Solanaceae | Solanum bulbocastanum | Ref. |
| Plantae | Solanaceae | Solanum canasense | Ref. |
| Plantae | Solanaceae | Solanum cardiophyllum | Ref. |
| Plantae | Solanaceae | Solanum chacoense | Ref. |
| Plantae | Solanaceae | Solanum commersonii  | Ref. |
| Plantae | Solanaceae | Solanum fendleri  | Ref. |
| Plantae | Solanaceae | Solanum hougasii | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum multidissectum | Ref. |
| Plantae | Solanaceae | Solanum pinnacritisectum | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
| Plantae | Styracaceae | Styrax benzoin  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| - | - | Erythoxylum coca | Ref. |
| - | - | Liquidamber orientalis | Ref. |
| - | - | Scrophalaria ningpoensis | Ref. |
|
|
zoom in
| Organism | Erythoxylum coca | | Reference | Boje, et al., Planta Med, 69, (2003), 820.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Nguyen, et al., Phytochemistry, 66, (2005), 1186.
Lan, et al., Journal of Natural Products, 66, (2003), 487.
Kim, et al., Phytochemistry, 54, (2000), 503.
Kundakovic, et al., Chem Pharm Bull, 52, (2004), 1462.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995). |
|---|
|