| Name |
Dihydroquercetin Taxifolin (2R,3R)-Taxifolin Distylin |
| Formula |
C15H12O7 |
| Mw |
304.05830274 |
| CAS RN |
480-18-2 |
| C_ID |
C00000677
, 
|
| InChIKey |
CXQWRCVTCMQVQX-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C15H12O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,14-19,21H/t14-,15+/m0/s1 |
| SMILES |
O=C1c2c(O)cc(O)cc2O[C@H](c2ccc(O)c(O)c2)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa | Ref. |
| Plantae | Anacardiaceae | Melanorrhoea spp. | Ref. |
| Plantae | Anacardiaceae | Pistacia chinensis | Ref. |
| Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
| Plantae | Annonaceae | Annona muricata | Ref. |
| Plantae | Annonaceae | Cleistopholis glauca | Ref. |
| Plantae | Apiaceae | Daucus carota | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis | Ref. |
| Plantae | Asteraceae | Anthemis altissima | Ref. |
| Plantae | Asteraceae | Pulicaria undulata | Ref. |
| Plantae | Boraginaceae | Heliotropium strigosum | Ref. |
| Plantae | Cactaceae | Opuntia ficus-indica var.saboten | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Platycodon grandiflorum | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia epunctata | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica carinata Y line | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia | Ref. |
| Plantae | Dilleniaceae | Dillenia spp. | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
| Plantae | Ephedraceae | Ephedra sinica | Ref. |
| Plantae | Ericaceae | Rhododendron brachycarpum ssp.brachycarpum | Ref. |
| Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
| Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
| Plantae | Ericaceae | Rhododendron degronianum ssp. Heptamerum var. hondoense | Ref. |
| Plantae | Ericaceae | Rhododendron dichroanthum ssp.scyphocalyx | Ref. |
| Plantae | Ericaceae | Rhododendron fortunei | Ref. |
| Plantae | Ericaceae | Rhododendron insigne | Ref. |
| Plantae | Ericaceae | Rhododendron kaempferi | Ref. |
| Plantae | Ericaceae | Rhododendron ponticum | Ref. |
| Plantae | Ericaceae | Rhododendron praevernum | Ref. |
| Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Ericaceae | Rhododendron ungernii | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum coca | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
| Plantae | Fabaceae | Acacia carnei | Ref. |
| Plantae | Fabaceae | Acacia catechu | Ref. |
| Plantae | Fabaceae | Colophospermum mopane | Ref. |
| Plantae | Fabaceae | Crotalaria assamica | Ref. |
| Plantae | Fabaceae | Crotalaria pallida | Ref. |
| Plantae | Fabaceae | Genista corsica | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
| Plantae | Fabaceae | Sophora flavescens | Ref. |
| Plantae | Fabaceae | Sophora japonica | Ref. |
| Plantae | Fabaceae | Spatholobus suberectus Dunn | Ref. |
| Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| Plantae | Haemodoraceae | Anigozanthos pulcherrimus | Ref. |
| Plantae | Haemodoraceae | Anigozanthos rufus | Ref. |
| Plantae | Juglandaceae | Juglans mandshurica | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum vulgare | Ref. |
| Plantae | Labiatae | Thymus vulgaris | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Lythraceae | Punica granatum L. | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
| Plantae | Moraceae | Morus alba | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
| Plantae | Orchidaceae | Gongora quinquenervis | Ref. |
| Plantae | Orchidaceae | Neomoorea wallisii | Ref. |
| Plantae | Pinaceae | Cedrus deodara | Ref. |
| Plantae | Pinaceae | Larix decidua | Ref. |
| Plantae | Pinaceae | Picea abies | Ref. |
| Plantae | Pinaceae | Picea obovata | Ref. |
| Plantae | Pinaceae | Pinus roxburghii | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Pseudotsuga menziesii | Ref. |
| Plantae | Plantaginaceae | Antirrhinum majus | Ref. |
| Plantae | Poaceae | Zea mays | Ref. |
| Plantae | Polygalaceae | Polygala caudata | Ref. |
| Plantae | Polygonaceae | Polygonum amphibium | Ref. |
| Plantae | Polygonaceae | Polygonum aviculare | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta | Ref. |
| Plantae | Polygonaceae | Polygonum convolvulus | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper | Ref. |
| Plantae | Polygonaceae | Polygonum lapathifolium | Ref. |
| Plantae | Polygonaceae | Polygonum mite | Ref. |
| Plantae | Polygonaceae | Polygonum nodosum | Ref. |
| Plantae | Polygonaceae | Polygonum orientale | Ref. |
| Plantae | Polygonaceae | Polygonum persicaria | Ref. |
| Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
| Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
| Plantae | Rhamnaceae | Rhamnus pallasii | Ref. |
| Plantae | Rosaceae | Prunus avium | Ref. |
| Plantae | Salicaceae | Salix caprea | Ref. |
| Plantae | Salicaceae | Salix purpurea | Ref. |
| Plantae | Sapindaceae | Xanthoceras sorbifolia | Ref. |
| Plantae | Schisandraceae | Kadsura heteroclita | Ref. |
| Plantae | Smilacaceae | Smilax glabra | Ref. |
| Plantae | Solanaceae | Capsicum annuum | Ref. |
| Plantae | Solanaceae | Petunia hybrida | Ref. |
| Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus mairei | Ref. |
| Plantae | Theaceae | Camellia sinensis | Ref. |
| Plantae | Verbenaceae | Lippia sidoides | Ref. |
| - | - | Equsetum arvense | Ref. |
| - | - | Nympaea spp. | Ref. |
|
|
zoom in
| Organism | Polygonum lapathifolium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|