| Name |
Chunganenol |
| Formula |
C85H64O18 |
| Mw |
1372.40926524 |
| CAS RN |
1187963-12-7 |
| C_ID |
C00063691
|
| InChIKey |
FTFAHGCTWYRGNY-LGGXSKLGSA-N |
| InChICode |
InChI=1S/C85H64O18/c86-47-14-1-39(2-15-47)3-26-57-75-68(102-83(42-8-20-50(89)21-9-42)72(75)45-27-53(92)31-54(93)28-45)38-69-76(57)73(84(103-69)43-10-22-51(90)23-11-43)46-29-62(96)60(63(97)30-46)36-58-59(32-55(94)34-64(58)98)77-71(41-6-18-49(88)19-7-41)81-70(40-4-16-48(87)17-5-40)74-61(33-56(95)35-65(74)99)78-80-67(37-66(100)79(77)82(80)81)101-85(78)44-12-24-52(91)25-13-44/h1-35,37-38,70-73,77-78,81,83-100H,36H2/b26-3+/t70-,71-,72-,73-,77-,78-,81+,83+,84+,85+/m0/s1 |
| SMILES |
Oc1ccc(C=Cc2c3c(cc4c2C(c2cc(O)c(Cc5c(O)cc(O)cc5C5c6c(O)cc7c8c6C(C(c6ccc(O)cc6)c6c(O)cc(O)cc6C8C(c6ccc(O)cc6)O7)C5c5ccc(O)cc5)c(O)c2)C(c2ccc(O)cc2)O4)OC(c2ccc(O)cc2)C3c2cc(O)cc(O)c2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis berlandieri | Ref. |
| Plantae | Vitaceae | Vitis betulifolia | Ref. |
| Plantae | Vitaceae | Vitis chunganensis | Ref. |
| Plantae | Vitaceae | Vitis coignetiae  | Ref. |
| Plantae | Vitaceae | Vitis davidii | Ref. |
| Plantae | Vitaceae | Vitis labrusca  | Ref. |
| Plantae | Vitaceae | Vitis pentagona | Ref. |
| Plantae | Vitaceae | Vitis riparia  | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| - | - | Muscadinia rotundifolia | Ref. |
|
|
zoom in
| Organism | Vitis riparia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|