| Name |
Cinchonine (+)-Cinchonine |
| Formula |
C19H22N2O |
| Mw |
294.17321334 |
| CAS RN |
118-10-5 |
| C_ID |
C00050560
|
| InChIKey |
|
| InChICode |
InChI=1S/C19H22N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,9,13-14,18-19,22H,1,8,10-12H2/t13-,14-,18+,19-/m0/s1 |
| SMILES |
C=C[C@H]1C[N@]2CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Diaporthaceae | Diaporthe sp. CLF-J | Ref. |
| Plantae | Oleaceae | Ligustrum vulgare  | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Oleaceae | Olea europea L.  | Ref. |
| Plantae | Rubiaceae | Anthocephalus chinensis L.  | Ref. |
| Plantae | Rubiaceae | Cinchona ledgeriana | Ref. |
| Plantae | Rubiaceae | Cinchona officinalis  | Ref. |
| Plantae | Rubiaceae | Cinchona robusta | Ref. |
| Plantae | Rubiaceae | Cinchona succirubra  | Ref. |
| Plantae | Rubiaceae | Remijia peruviana  | Ref. |
|
|
zoom in
| Organism | Cinchona succirubra | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|