| Name |
7alpha-Hydroxyroyleanone Horminone |
| Formula |
C20H28O4 |
| Mw |
332.19875938 |
| CAS RN |
21887-01-4 |
| C_ID |
C00036123
, 
|
| InChIKey |
YVSUCPNWDPTGKM-SEPUWMDANA-N |
| InChICode |
InChI=1S/C20H28O4/c1-10(2)13-16(22)14-11(21)9-12-19(3,4)7-6-8-20(12,5)15(14)18(24)17(13)23/h10-12,21,23H,6-9H2,1-5H3/t11-,12+,20+/m1/s1 |
| SMILES |
CC(C)C1=C(O)C(=O)C2=C(C1=O)[C@H](O)C[C@H]1C(C)(C)CCC[C@]21C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia amplexicaulis Lam. | Ref. |
| Plantae | Labiatae | Salvia austriaca | Ref. |
| Plantae | Labiatae | Salvia blepharochaena Hedge and Hub.Mor. | Ref. |
| Plantae | Labiatae | Salvia blepharochlaena | Ref. |
| Plantae | Labiatae | Salvia bracteata Banks and Sol. | Ref. |
| Plantae | Labiatae | Salvia eriophora Boiss and Kotschy | Ref. |
| Plantae | Labiatae | Salvia tomentosa | Ref. |
| Plantae | Labiatae | Salvia verticillata | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
|
|
zoom in
| Organism | Taiwania cryptomerioides | | Reference | https://doi.org/10.1016/0031-9422(95)00358-E |
|---|
|