| Name |
Salicylaldehyde |
| Formula |
C7H6O2 |
| Mw |
122.03677944 |
| CAS RN |
90-02-8 |
| C_ID |
C00031273
, 
|
| InChIKey |
SMQUZDBALVYZAC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H6O2/c8-5-6-3-1-2-4-7(6)9/h1-5,9H |
| SMILES |
O=Cc1ccccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Lauraceae | Cinnamomum versum | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Salicaceae | Salix babylonica  | Ref. |
| Plantae | Solanaceae | Solanum melongena  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
|
|
zoom in
| Organism | Camellia sinensis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|