| Name |
Pomolic acid |
| Formula |
C30H48O4 |
| Mw |
472.35526002 |
| CAS RN |
13849-91-7 |
| C_ID |
C00031074
, 
|
| InChIKey |
ZZTYPLSBNNGEIS-FVVLLKQSNA-N |
| InChICode |
InChI=1S/C30H48O4/c1-18-10-15-30(24(32)33)17-16-27(5)19(23(30)29(18,7)34)8-9-21-26(4)13-12-22(31)25(2,3)20(26)11-14-28(21,27)6/h8,18,20-23,31,34H,9-17H2,1-7H3,(H,32,33)/t18-,20+,21-,22+,23-,26+,27-,28-,29-,30+/m1/s1 |
| SMILES |
C[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2[C@]1(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aquifoliaceae | Ilex asprella | Ref. |
| Plantae | Aquifoliaceae | Ilex pubescens  | Ref. |
| Plantae | Araliaceae | Centella asiatica  | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Labiatae | Perilla frutescens (L.) Britton var.japonica Hara  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia trijuga | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
| Plantae | Myrtaceae | Syzygium buxifolium | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Rosaceae | Chaenomeles japonica  | Ref. |
| Plantae | Rosaceae | Duchesnea indica  | Ref. |
| Plantae | Rosaceae | Pyrus malus L.  | Ref. |
| Plantae | Rosaceae | Sanguisorba officinalis  | Ref. |
| Plantae | Verbenaceae | Lantana camara  | Ref. |
| - | - | Trogopterus xanthipes  | Ref. |
|
|
zoom in
| Organism | Coleus aromaticus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|