| Name |
2alpha,3beta-Dihydroxyolean-12-en-28-oic acid Maslinic acid Crategolic acid |
| Formula |
C30H48O4 |
| Mw |
472.35526002 |
| CAS RN |
4373-41-5 |
| C_ID |
C00030742
, 
|
| InChIKey |
MDZKJHQSJHYOHJ-YEBDSSMWNA-N |
| InChICode |
InChI=1S/C30H48O4/c1-25(2)12-14-30(24(33)34)15-13-28(6)18(19(30)16-25)8-9-22-27(5)17-20(31)23(32)26(3,4)21(27)10-11-29(22,28)7/h8,19-23,31-32H,9-17H2,1-7H3,(H,33,34)/t19-,20-,21+,22-,23+,27+,28-,29-,30+/m1/s1 |
| SMILES |
CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Anisomeles indica  | Ref. |
| Plantae | Labiatae | Callicarpa arborea  | Ref. |
| Plantae | Labiatae | Callicarpa macrophylla  | Ref. |
| Plantae | Labiatae | Hyptis brevipes  | Ref. |
| Plantae | Labiatae | Leucas aspera  | Ref. |
| Plantae | Labiatae | Meriandra benghalensis  | Ref. |
| Plantae | Labiatae | Ocimum spicatum | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
| Plantae | Lythraceae | Punica granatum LINN.  | Ref. |
| Plantae | Malvaceae | Durio kutejensis  | Ref. |
| Plantae | Malvaceae | Grewia bilamellata | Ref. |
| Plantae | Myricaceae | Myrica rubra  | Ref. |
| Plantae | Myrtaceae | Eugenia sandwicensis | Ref. |
| Plantae | Myrtaceae | Syzygium aromatica  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus pumilio | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Rosaceae | Chaenomeles sinensis KOEHNE  | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia gymnanthera | Ref. |
| Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense  | Ref. |
| Plantae | Ulmaceae | Ulmus pumila L.  | Ref. |
|
|
zoom in
| Organism | Coleus aromaticus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|