| Name |
2-Methylbutanoic acid 2-Methylbutyric acid |
| Formula |
C5H10O2 |
| Mw |
102.06807956 |
| CAS RN |
116-53-0 |
| C_ID |
C00029461
, 
|
| InChIKey |
WLAMNBDJUVNPJU-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/t4-/m0/s1 |
| SMILES |
CCC(C)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Skin microbiota) | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Boraginaceae | Lithospermum erythrorhizon  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
|
|
zoom in
| Organism | Plantago lanceolata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|