| Name |
(-)-Salutaridine Sinoacutine (-)-Sinoacutine |
| Formula |
C19H21NO4 |
| Mw |
327.14705817 |
| CAS RN |
4090-18-0 |
| C_ID |
C00025629
, 
|
| InChIKey |
GVTRUVGBZQJVTF-KINVLMLONA-N |
| InChICode |
InChI=1S/C19H21NO4/c1-20-7-6-19-10-16(24-3)14(21)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9-10,13,22H,6-8H2,1-3H3/t13-,19+/m0/s1 |
| SMILES |
COC1=C[C@@]23CCN(C)[C@@H](Cc4ccc(OC)c(O)c42)C3=CC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Artabotrys uncinatus  | Ref. |
| Plantae | Berberidaceae | Nandina domestica  | Ref. |
| Plantae | Fumariaceae | Ceratocapnos palaestinus | Ref. |
| Plantae | Fumariaceae | Corydalis cava  | Ref. |
| Plantae | Fumariaceae | Corydalis incisa | Ref. |
| Plantae | Fumariaceae | Corydalis majori | Ref. |
| Plantae | Fumariaceae | Corydalis ochroleuca | Ref. |
| Plantae | Fumariaceae | Corydalis pallida | Ref. |
| Plantae | Fumariaceae | Corydalis pallida var.tenuis | Ref. |
| Plantae | Fumariaceae | Corydalis solida  | Ref. |
| Plantae | Fumariaceae | Corydalis stewartii | Ref. |
| Plantae | Fumariaceae | Platycapnos saxicola | Ref. |
| Plantae | Lauraceae | Dehaasia longipedicellata | Ref. |
| Plantae | Menispermaceae | Antizoma angustifolia Miers | Ref. |
| Plantae | Menispermaceae | Sinomenium acutum Rehder & Wilson  | Ref. |
| Plantae | Menispermaceae | Stephania brachyandra Diels | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha Hayata  | Ref. |
| Plantae | Menispermaceae | Stephania dielsiana Y.C.Wu | Ref. |
| Plantae | Menispermaceae | Stephania elegans Hook.& Thoms. | Ref. |
| Plantae | Menispermaceae | Stephania epigaea H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania gracilenta Miers | Ref. |
| Plantae | Menispermaceae | Stephania mashanica H.S.Lo.et.B.N.Chang | Ref. |
| Plantae | Menispermaceae | Stephania micrantha H.S.Lo.et.M.Yang | Ref. |
| Plantae | Menispermaceae | Stephania officinarum | Ref. |
| Plantae | Menispermaceae | Stephania pierrei Diels (=S.erecta Craib)  | Ref. |
| Plantae | Menispermaceae | Stephania yunnanensis H.S Lo | Ref. |
| Plantae | Papaveraceae | Glaucium controruplicatum | Ref. |
| - | - | Flatycapnos saxicola | Ref. |
|
|
zoom in
| Organism | Corydalis pallida var.tenuis | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Hsieh, et al., JNP, 64, (2001), 1157.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|