| Name |
Norchelerythrine De-N-methylchelerythrine Des-N-methylchelerythrine N-Norchelerythrine O-Methyldecarine |
| Formula |
C20H15NO4 |
| Mw |
333.10010798 |
| CAS RN |
6900-99-8 |
| C_ID |
C00024655
, 
|
| InChIKey |
JGUNQXPMULKFNY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H15NO4/c1-22-16-6-5-12-13-4-3-11-7-17-18(25-10-24-17)8-14(11)19(13)21-9-15(12)20(16)23-2/h3-9H,10H2,1-2H3 |
| SMILES |
COc1ccc2c(cnc3c4cc5c(cc4ccc23)OCO5)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Papaveraceae | Chelidonium japonicum Thumb. | Ref. |
| Plantae | Rutaceae | Fagara ailanthoides | Ref. |
| Plantae | Rutaceae | Fagara pterota | Ref. |
| Plantae | Rutaceae | Fagara rhoifolia | Ref. |
| Plantae | Rutaceae | Toddalia asiatica Lamk.  | Ref. |
| Plantae | Rutaceae | Zanthoxylum ailanthoides | Ref. |
| Plantae | Rutaceae | Zanthoxylum chiloperone var. angustifolium | Ref. |
| Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
| Plantae | Rutaceae | Zanthoxylum spinosum Swingle | Ref. |
| Plantae | Rutaceae | Zanthoxylum usumbarense | Ref. |
|
|
zoom in
| Organism | Zanthoxylum spinosum Swingle | | Reference | Gray,The Chemistry and Biology of Isoquinoline Alkaloids,London,April 16-18,(1984),20 |
|---|
|