| Name |
beta-Curcumene (-)-beta-Curcumene l-beta-Curcumene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
28976-67-2 |
| C_ID |
C00011630
, 
|
| InChIKey |
JXZQZARENYGJMK-YQTOOIBONA-N |
| InChICode |
InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8,11,14H,5,7,9-10H2,1-4H3/t14-/m1/s1 |
| SMILES |
CC(C)=CCC[C@@H](C)C1=CCC(C)=CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Curcuma aromatica  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma xanthorrhiza  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|