| Name |
Piperitone oxide 1,2-Epoxy-p-menthan-3-one |
| Formula |
C10H16O2 |
| Mw |
168.11502975 |
| CAS RN |
5286-38-4 |
| C_ID |
C00010830
, 
|
| InChIKey |
IAFONZHDZMCORS-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C10H16O2/c1-6(2)7-4-5-10(3)9(12-10)8(7)11/h6-7,9H,4-5H2,1-3H3/t7-,9+,10+/m1/s1 |
| SMILES |
CC(C)C1CCC2(C)OC2C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Mentha piperita L.  | Ref. |
| Plantae | Labiatae | Mentha rotundifolia  | Ref. |
| Plantae | Labiatae | Mentha sauveolens | Ref. |
| Plantae | Labiatae | Mentha sylvestris | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta subsp.glandulosa.  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
|
|
zoom in
| Organism | Veronica spicata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|