| Name |
Prodelphinidin C |
| Formula |
C30H26O13 |
| Mw |
594.13734092 |
| CAS RN |
78392-25-3 |
| C_ID |
C00009111
, 
|
| InChIKey |
ZYDDITZPGFXQSD-BPWZFFQGNA-N |
| InChICode |
InChI=1S/C30H26O13/c31-12-6-17(35)23-22(7-12)42-29(11-4-19(37)26(40)20(38)5-11)27(41)25(23)24-18(36)9-15(33)13-8-21(39)28(43-30(13)24)10-1-2-14(32)16(34)3-10/h1-7,9,21,25,27-29,31-41H,8H2/t21-,25+,27+,28-,29-/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Corylus avellana  | Ref. |
| Plantae | Cistaceae | Cistus incanus | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fagaceae | Quercus dentata | Ref. |
| Plantae | Fagaceae | Quercus miyagii | Ref. |
| Plantae | Hamamelidaceae | Hamamelis sp. | Ref. |
| Plantae | Myricaceae | Myrica nagi  | Ref. |
| Plantae | Poaceae | Hordeum vulgare  | Ref. |
| Plantae | Salicaceae | Salix caprea  | Ref. |
|
|
zoom in
| Organism | Salix caprea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Foo,J.Chem.Soc.Perkin Trans,1,(1978),1186
Brandon,Phytochem.,21,(1982),2953 |
|---|
|