| Name |
Isoliquiritoside Isoliquiritin |
| Formula |
C21H22O9 |
| Mw |
418.1263823 |
| CAS RN |
5041-81-6 |
| C_ID |
C00007184
, 
|
| InChIKey |
YNWXJFQOCHMPCK-IFHLCVGENA-N |
| InChICode |
InChI=1S/C21H22O9/c22-10-17-18(26)19(27)20(28)21(30-17)29-13-5-1-11(2-6-13)3-8-15(24)14-7-4-12(23)9-16(14)25/h1-9,17-23,25-28H,10H2/b8-3+/t17-,18-,19+,20-,21-/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)cc1)c1ccc(O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium chinense  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza kansuensis | Ref. |
| Plantae | Fabaceae | Glycyrrhiza spp. | Ref. |
| Plantae | Fabaceae | Glycyrrhiza spp., | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
|
|
zoom in
| Organism | Trifolium subterraneum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Wong,Phytochem.,7,(1968),2123
Van Hulle,Planta Med.,20,(1971),278 |
|---|
|